![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| sensor_music.php | 2005-06-17 19:08 | 2.5K | |
| mp3_playlist.xml.php | 2005-03-18 22:09 | 1.1K | |
| empathy_mp3.swf | 2005-03-17 21:07 | 52K | |
| 14 song for lost items.mp3 | 2001-03-07 09:00 | 2.5M | |
| 13 prelude to bear dreams.mp3 | 2001-03-07 09:00 | 12M | |
| 12 kenosis_when my savior is at hand.mp3 | 2001-03-07 08:59 | 16M | |
| 10 ghost of the klokker.mp3 | 2001-03-07 08:59 | 5.2M | |
| 09 the squonk and his sad tale.mp3 | 2001-03-07 08:59 | 12M | |
| 08 we can't wait anymore for silent tristeros's empire.mp3 | 2001-03-07 08:59 | 15M | |
| 07 chemical cow's TV secret.mp3 | 2001-03-07 08:58 | 4.7M | |
| 06 a longing for the golden country.mp3 | 2001-03-07 08:58 | 3.4M | |
| 05 mars manifesto.mp3 | 2001-03-07 08:58 | 3.4M | |
| 03 beams of now.mp3 | 2001-03-07 08:58 | 2.6M | |
| 02 theres no sidewalks in the suburbs.mp3 | 2001-03-07 08:58 | 14M | |
| 01 epiphaneia.mp3 | 2001-03-07 08:58 | 17M | |